About 2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane
2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane (PubChem CID 141083903) has the molecular formula C24H50O8
and a molecular weight of 466.66 g/mol. Its IUPAC name is 2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane.
Molecular Properties
| Compound Name | 2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane |
| PubChem CID | 141083903 |
| Molecular Formula | C24H50O8 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | 2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane |
| SMILES | CC(C)(C)OOCCCCOOC(C)(C)CCC(C)(C)OOCCCCOOC(C)(C)C |
| InChI | InChI=1S/C24H50O8/c1-21(2,3)29-25-17-11-13-19-27-31-23(7,8)15-16-24(9,10)32-28-20-14-12-18-26-30-22(4,5)6/h11-20H2,1-10H3 |
| InChIKey | BETSFLOIWRYEII-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane?
The IUPAC name of 2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane (CID 141083903) is 2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane.
What is the SMILES notation for 2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane?
The canonical SMILES for 2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane is CC(C)(C)OOCCCCOOC(C)(C)CCC(C)(C)OOCCCCOOC(C)(C)C.
What is the InChIKey of 2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane?
The InChIKey is BETSFLOIWRYEII-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50O8/c1-21(2,3)29-25-17-11-13-19-27-31-23(7,8)15-16-24(9,10)32-28-20-14-12-18-26-30-22(4,5)6/h11-20H2,1-10H3.
What are the key properties of 2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane?
2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane has a molecular weight of 466.66 g/mol, XLogP of 6.27, 19 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(4-tert-butylperoxybutylperoxy)-2,5-dimethylhexane is sourced from PubChem (CID 141083903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).