C9H11F2N — CID 141084245
4-(4,4-difluorobutyl)pyridine (PubChem CID 141084245) has the molecular formula C9H11F2N and a molecular weight of 171.19 g/mol. Its IUPAC name is 4-(4,4-difluorobutyl)pyridine.
| Compound Name | 4-(4,4-difluorobutyl)pyridine |
|---|---|
| PubChem CID | 141084245 |
| Molecular Formula | C9H11F2N |
| Molecular Weight | 171.19 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 4-(4,4-difluorobutyl)pyridine |
| SMILES | FC(F)CCCc1ccncc1 |
| InChI | InChI=1S/C9H11F2N/c10-9(11)3-1-2-8-4-6-12-7-5-8/h4-7,9H,1-3H2 |
| InChIKey | ZXDYBOORKWFTSI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |