About 10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one
10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one (PubChem CID 141085314) has the molecular formula C22H30O3S
and a molecular weight of 374.55 g/mol. Its IUPAC name is 10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one.
Molecular Properties
| Compound Name | 10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one |
| PubChem CID | 141085314 |
| Molecular Formula | C22H30O3S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one |
| SMILES | Cc1ccc(C)c(SC2=C(O)CC3(CCCC(C(C)(C)C)C3)OC2=O)c1 |
| InChI | InChI=1S/C22H30O3S/c1-14-8-9-15(2)18(11-14)26-19-17(23)13-22(25-20(19)24)10-6-7-16(12-22)21(3,4)5/h8-9,11,16,23H,6-7,10,12-13H2,1-5H3 |
| InChIKey | RZHFPNGFOQIZEW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one?
The IUPAC name of 10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one (CID 141085314) is 10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one.
What is the SMILES notation for 10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one?
The canonical SMILES for 10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one is Cc1ccc(C)c(SC2=C(O)CC3(CCCC(C(C)(C)C)C3)OC2=O)c1.
What is the InChIKey of 10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one?
The InChIKey is RZHFPNGFOQIZEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O3S/c1-14-8-9-15(2)18(11-14)26-19-17(23)13-22(25-20(19)24)10-6-7-16(12-22)21(3,4)5/h8-9,11,16,23H,6-7,10,12-13H2,1-5H3.
What are the key properties of 10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one?
10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one has a molecular weight of 374.55 g/mol, XLogP of 6.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-tert-butyl-3-(2,5-dimethylphenyl)sulfanyl-4-hydroxy-1-oxaspiro[5.5]undec-3-en-2-one is sourced from PubChem (CID 141085314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).