C18H26N2O4S — CID 141085913
3-[3-methyl-4-[(1-propylpyrazol-4-yl)methyl]phenoxy]propyl methanesulfonate (PubChem CID 141085913) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 3-[3-methyl-4-[(1-propylpyrazol-4-yl)methyl]phenoxy]propyl methanesulfonate.
| Compound Name | 3-[3-methyl-4-[(1-propylpyrazol-4-yl)methyl]phenoxy]propyl methanesulfonate |
|---|---|
| PubChem CID | 141085913 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 3-[3-methyl-4-[(1-propylpyrazol-4-yl)methyl]phenoxy]propyl methanesulfonate |
| SMILES | CCCn1cc(Cc2ccc(OCCCOS(C)(=O)=O)cc2C)cn1 |
| InChI | InChI=1S/C18H26N2O4S/c1-4-8-20-14-16(13-19-20)12-17-6-7-18(11-15(17)2)23-9-5-10-24-25(3,21)22/h6-7,11,13-14H,4-5,8-10,12H2,1-3H3 |
| InChIKey | WKDOJDZLNKCHCY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|