About 2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol
2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol (PubChem CID 141086681) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol |
| PubChem CID | 141086681 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol |
| SMILES | CCC1OC=C(C)N1CCO |
| InChI | InChI=1S/C8H15NO2/c1-3-8-9(4-5-10)7(2)6-11-8/h6,8,10H,3-5H2,1-2H3 |
| InChIKey | GOLOJEXKDCZADD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol?
The IUPAC name of 2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol (CID 141086681) is 2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol.
What is the SMILES notation for 2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol?
The canonical SMILES for 2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol is CCC1OC=C(C)N1CCO.
What is the InChIKey of 2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol?
The InChIKey is GOLOJEXKDCZADD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-3-8-9(4-5-10)7(2)6-11-8/h6,8,10H,3-5H2,1-2H3.
What are the key properties of 2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol?
2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol has a molecular weight of 157.21 g/mol, XLogP of 0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethyl-4-methyl-2H-1,3-oxazol-3-yl)ethanol is sourced from PubChem (CID 141086681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).