About (2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide
(2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide (PubChem CID 141087184) has the molecular formula C5H10FN3O
and a molecular weight of 147.15 g/mol. Its IUPAC name is (2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide.
Molecular Properties
| Compound Name | (2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide |
| PubChem CID | 141087184 |
| Molecular Formula | C5H10FN3O |
| Molecular Weight | 147.15 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | (2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide |
| SMILES | NC(=NO)[C@@H]1C[C@H](F)CN1 |
| InChI | InChI=1S/C5H10FN3O/c6-3-1-4(8-2-3)5(7)9-10/h3-4,8,10H,1-2H2,(H2,7,9)/t3-,4-/m0/s1 |
| InChIKey | GVNWEXGMXREHSQ-IMJSIDKUSA-N |
| XLogP | -0.57 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.15 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide?
The IUPAC name of (2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide (CID 141087184) is (2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide.
What is the SMILES notation for (2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide?
The canonical SMILES for (2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide is NC(=NO)[C@@H]1C[C@H](F)CN1.
What is the InChIKey of (2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide?
The InChIKey is GVNWEXGMXREHSQ-IMJSIDKUSA-N. The full InChI is InChI=1S/C5H10FN3O/c6-3-1-4(8-2-3)5(7)9-10/h3-4,8,10H,1-2H2,(H2,7,9)/t3-,4-/m0/s1.
What are the key properties of (2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide?
(2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide has a molecular weight of 147.15 g/mol, XLogP of -0.57, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-4-fluoro-N'-hydroxypyrrolidine-2-carboximidamide is sourced from PubChem (CID 141087184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).