C22H24FN3O — CID 141087260
4-[2-[4-(4-fluorophenyl)-1-methyl-3-pyridin-4-ylpyrrol-2-yl]ethyl]morpholine (PubChem CID 141087260) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is 4-[2-[4-(4-fluorophenyl)-1-methyl-3-pyridin-4-ylpyrrol-2-yl]ethyl]morpholine.
| Compound Name | 4-[2-[4-(4-fluorophenyl)-1-methyl-3-pyridin-4-ylpyrrol-2-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 141087260 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 4-[2-[4-(4-fluorophenyl)-1-methyl-3-pyridin-4-ylpyrrol-2-yl]ethyl]morpholine |
| SMILES | Cn1cc(-c2ccc(F)cc2)c(-c2ccncc2)c1CCN1CCOCC1 |
| InChI | InChI=1S/C22H24FN3O/c1-25-16-20(17-2-4-19(23)5-3-17)22(18-6-9-24-10-7-18)21(25)8-11-26-12-14-27-15-13-26/h2-7,9-10,16H,8,11-15H2,1H3 |
| InChIKey | IQJDHKJSDRMJRK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |