About 2-piperazin-1-ylbenzoyl bromide
2-piperazin-1-ylbenzoyl bromide (PubChem CID 141087423) has the molecular formula C11H13BrN2O
and a molecular weight of 269.14 g/mol. Its IUPAC name is 2-piperazin-1-ylbenzoyl bromide.
Molecular Properties
| Compound Name | 2-piperazin-1-ylbenzoyl bromide |
| PubChem CID | 141087423 |
| Molecular Formula | C11H13BrN2O |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 2-piperazin-1-ylbenzoyl bromide |
| SMILES | O=C(Br)c1ccccc1N1CCNCC1 |
| InChI | InChI=1S/C11H13BrN2O/c12-11(15)9-3-1-2-4-10(9)14-7-5-13-6-8-14/h1-4,13H,5-8H2 |
| InChIKey | IYERQOAJLSTXIB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-piperazin-1-ylbenzoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-ylbenzoyl bromide?
The IUPAC name of 2-piperazin-1-ylbenzoyl bromide (CID 141087423) is 2-piperazin-1-ylbenzoyl bromide.
What is the SMILES notation for 2-piperazin-1-ylbenzoyl bromide?
The canonical SMILES for 2-piperazin-1-ylbenzoyl bromide is O=C(Br)c1ccccc1N1CCNCC1.
What is the InChIKey of 2-piperazin-1-ylbenzoyl bromide?
The InChIKey is IYERQOAJLSTXIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrN2O/c12-11(15)9-3-1-2-4-10(9)14-7-5-13-6-8-14/h1-4,13H,5-8H2.
What are the key properties of 2-piperazin-1-ylbenzoyl bromide?
2-piperazin-1-ylbenzoyl bromide has a molecular weight of 269.14 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-ylbenzoyl bromide is sourced from PubChem (CID 141087423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).