C23H40O13 — CID 141087748
[(2R,3R,4S,5S,6R)-2-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (E)-undec-2-enoate (PubChem CID 141087748) has the molecular formula C23H40O13 and a molecular weight of 524.56 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-2-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (E)-undec-2-enoate.
| Compound Name | [(2R,3R,4S,5S,6R)-2-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (E)-undec-2-enoate |
|---|---|
| PubChem CID | 141087748 |
| Molecular Formula | C23H40O13 |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-2-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (E)-undec-2-enoate |
| SMILES | CCCCCCCC/C=C/C(=O)O[C@@]1(OC2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H40O13/c1-2-3-4-5-6-7-8-9-10-16(27)35-23(21(32)19(30)17(28)14(11-24)34-23)36-22(13-26)20(31)18(29)15(12-25)33-22/h9-10,14-15,17-21,24-26,28-32H,2-8,11-13H2,1H3/b10-9+/t14-,15-,17-,18-,19+,20+,21-,22?,23+/m1/s1 |
| InChIKey | IMSQDPNKYVUCOK-HJTUCPIGSA-N |
| XLogP | -2.22 |
| TPSA | 215.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|