C14H26O2 — CID 141089805
2,3-dimethylbutan-2-yl 2-methylhept-5-enoate (PubChem CID 141089805) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl 2-methylhept-5-enoate.
| Compound Name | 2,3-dimethylbutan-2-yl 2-methylhept-5-enoate |
|---|---|
| PubChem CID | 141089805 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2,3-dimethylbutan-2-yl 2-methylhept-5-enoate |
| SMILES | CC=CCCC(C)C(=O)OC(C)(C)C(C)C |
| InChI | InChI=1S/C14H26O2/c1-7-8-9-10-12(4)13(15)16-14(5,6)11(2)3/h7-8,11-12H,9-10H2,1-6H3 |
| InChIKey | WUHSUNMGCHEQNZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|