C7H4F8N2 — CID 141090064
5-(1,2,2,3,3-pentafluoropropyl)-4-(trifluoromethyl)-1H-pyrazole (PubChem CID 141090064) has the molecular formula C7H4F8N2 and a molecular weight of 268.11 g/mol. Its IUPAC name is 5-(1,2,2,3,3-pentafluoropropyl)-4-(trifluoromethyl)-1H-pyrazole.
| Compound Name | 5-(1,2,2,3,3-pentafluoropropyl)-4-(trifluoromethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 141090064 |
| Molecular Formula | C7H4F8N2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 5-(1,2,2,3,3-pentafluoropropyl)-4-(trifluoromethyl)-1H-pyrazole |
| SMILES | FC(F)C(F)(F)C(F)c1[nH]ncc1C(F)(F)F |
| InChI | InChI=1S/C7H4F8N2/c8-4(6(11,12)5(9)10)3-2(1-16-17-3)7(13,14)15/h1,4-5H,(H,16,17) |
| InChIKey | ZVVLAHOHWXNMOM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|