C11H19F6NO3 — CID 141091266
1-amino-2,5-bis(trifluoromethyl)nonane-1,3,6-triol (PubChem CID 141091266) has the molecular formula C11H19F6NO3 and a molecular weight of 327.27 g/mol. Its IUPAC name is 1-amino-2,5-bis(trifluoromethyl)nonane-1,3,6-triol.
| Compound Name | 1-amino-2,5-bis(trifluoromethyl)nonane-1,3,6-triol |
|---|---|
| PubChem CID | 141091266 |
| Molecular Formula | C11H19F6NO3 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-amino-2,5-bis(trifluoromethyl)nonane-1,3,6-triol |
| SMILES | CCCC(O)C(CC(O)C(C(N)O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H19F6NO3/c1-2-3-6(19)5(10(12,13)14)4-7(20)8(9(18)21)11(15,16)17/h5-9,19-21H,2-4,18H2,1H3 |
| InChIKey | PKQKIGQEYDMKFS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|