C15H30O4Si — CID 141091505
3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-oxoheptanoic acid (PubChem CID 141091505) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-oxoheptanoic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-oxoheptanoic acid |
|---|---|
| PubChem CID | 141091505 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-oxoheptanoic acid |
| SMILES | CCC(=O)CC(O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C15H30O4Si/c1-9-11(16)10-12(15(5,6)13(17)18)19-20(7,8)14(2,3)4/h12H,9-10H2,1-8H3,(H,17,18) |
| InChIKey | QIBPZZYFGRZSMH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|