C13H20N10O — CID 141091580
5-(4,6-diamino-1,3,5-triazin-2-yl)-3-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethyl]pentan-2-one (PubChem CID 141091580) has the molecular formula C13H20N10O and a molecular weight of 332.37 g/mol. Its IUPAC name is 5-(4,6-diamino-1,3,5-triazin-2-yl)-3-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethyl]pentan-2-one.
| Compound Name | 5-(4,6-diamino-1,3,5-triazin-2-yl)-3-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethyl]pentan-2-one |
|---|---|
| PubChem CID | 141091580 |
| Molecular Formula | C13H20N10O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 5-(4,6-diamino-1,3,5-triazin-2-yl)-3-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethyl]pentan-2-one |
| SMILES | CC(=O)C(CCc1nc(N)nc(N)n1)CCc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C13H20N10O/c1-6(24)7(2-4-8-18-10(14)22-11(15)19-8)3-5-9-20-12(16)23-13(17)21-9/h7H,2-5H2,1H3,(H4,14,15,18,19,22)(H4,16,17,20,21,23) |
| InChIKey | CDMMPBBKJVYSNC-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 198.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |