About 1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate
1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate (PubChem CID 141092374) has the molecular formula C12H15NO9
and a molecular weight of 317.25 g/mol. Its IUPAC name is 1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate.
Molecular Properties
| Compound Name | 1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate |
| PubChem CID | 141092374 |
| Molecular Formula | C12H15NO9 |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate |
| SMILES | CCCOC(=O)C(C(C)=O)(C(=O)OC)C(=O)OC(=O)NC=O |
| InChI | InChI=1S/C12H15NO9/c1-4-5-21-9(17)12(7(2)15,8(16)20-3)10(18)22-11(19)13-6-14/h6H,4-5H2,1-3H3,(H,13,14,19) |
| InChIKey | LJMYPJPWJQWHBS-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate?
The IUPAC name of 1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate (CID 141092374) is 1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate.
What is the SMILES notation for 1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate?
The canonical SMILES for 1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate is CCCOC(=O)C(C(C)=O)(C(=O)OC)C(=O)OC(=O)NC=O.
What is the InChIKey of 1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate?
The InChIKey is LJMYPJPWJQWHBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO9/c1-4-5-21-9(17)12(7(2)15,8(16)20-3)10(18)22-11(19)13-6-14/h6H,4-5H2,1-3H3,(H,13,14,19).
What are the key properties of 1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate?
1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate has a molecular weight of 317.25 g/mol, XLogP of -0.90, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(formylcarbamoyl) 1-O-methyl 1-O-propyl 2-oxopropane-1,1,1-tricarboxylate is sourced from PubChem (CID 141092374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).