About (1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate
(1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate (PubChem CID 141092488) has the molecular formula C14H12N2O7
and a molecular weight of 320.26 g/mol. Its IUPAC name is (1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | (1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 141092488 |
| Molecular Formula | C14H12N2O7 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate |
| SMILES | O=C(OC(=O)C1([N+](=O)[O-])C=CC=CC1)C1([N+](=O)[O-])C=CC=CC1 |
| InChI | InChI=1S/C14H12N2O7/c17-11(13(15(19)20)7-3-1-4-8-13)23-12(18)14(16(21)22)9-5-2-6-10-14/h1-7,9H,8,10H2 |
| InChIKey | OKVILCWUCRKVKV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of (1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate (CID 141092488) is (1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for (1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for (1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate is O=C(OC(=O)C1([N+](=O)[O-])C=CC=CC1)C1([N+](=O)[O-])C=CC=CC1.
What is the InChIKey of (1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate?
The InChIKey is OKVILCWUCRKVKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O7/c17-11(13(15(19)20)7-3-1-4-8-13)23-12(18)14(16(21)22)9-5-2-6-10-14/h1-7,9H,8,10H2.
What are the key properties of (1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate?
(1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate has a molecular weight of 320.26 g/mol, XLogP of 1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-nitrocyclohexa-2,4-diene-1-carbonyl) 1-nitrocyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 141092488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).