About 3-ethenyl-1-hexylindole
3-ethenyl-1-hexylindole (PubChem CID 141093384) has the molecular formula C16H21N
and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-ethenyl-1-hexylindole.
Molecular Properties
| Compound Name | 3-ethenyl-1-hexylindole |
| PubChem CID | 141093384 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 3-ethenyl-1-hexylindole |
| SMILES | C=Cc1cn(CCCCCC)c2ccccc12 |
| InChI | InChI=1S/C16H21N/c1-3-5-6-9-12-17-13-14(4-2)15-10-7-8-11-16(15)17/h4,7-8,10-11,13H,2-3,5-6,9,12H2,1H3 |
| InChIKey | LYSIFIHFXVEIKR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-1-hexylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-1-hexylindole?
The IUPAC name of 3-ethenyl-1-hexylindole (CID 141093384) is 3-ethenyl-1-hexylindole.
What is the SMILES notation for 3-ethenyl-1-hexylindole?
The canonical SMILES for 3-ethenyl-1-hexylindole is C=Cc1cn(CCCCCC)c2ccccc12.
What is the InChIKey of 3-ethenyl-1-hexylindole?
The InChIKey is LYSIFIHFXVEIKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N/c1-3-5-6-9-12-17-13-14(4-2)15-10-7-8-11-16(15)17/h4,7-8,10-11,13H,2-3,5-6,9,12H2,1H3.
What are the key properties of 3-ethenyl-1-hexylindole?
3-ethenyl-1-hexylindole has a molecular weight of 227.35 g/mol, XLogP of 4.86, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-1-hexylindole is sourced from PubChem (CID 141093384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).