C28H17IO3S — CID 141093677
2-iodonio-3,4-diphenylpyrene-1-sulfonate (PubChem CID 141093677) has the molecular formula C28H17IO3S and a molecular weight of 560.41 g/mol. Its IUPAC name is 2-iodonio-3,4-diphenylpyrene-1-sulfonate.
| Compound Name | 2-iodonio-3,4-diphenylpyrene-1-sulfonate |
|---|---|
| PubChem CID | 141093677 |
| Molecular Formula | C28H17IO3S |
| Molecular Weight | 560.41 g/mol |
| Exact Mass | 559.99 |
| IUPAC Name | 2-iodonio-3,4-diphenylpyrene-1-sulfonate |
| SMILES | O=S(=O)([O-])c1c([IH+])c(-c2ccccc2)c2c(-c3ccccc3)cc3cccc4ccc1c2c43 |
| InChI | InChI=1S/C28H17IO3S/c29-27-24(18-10-5-2-6-11-18)26-22(17-8-3-1-4-9-17)16-20-13-7-12-19-14-15-21(25(26)23(19)20)28(27)33(30,31)32/h1-16,29H |
| InChIKey | UQVWFKGSORGZHT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|