C24H17O4P — CID 141093976
2-[2,3-bis(2-hydroxyphenyl)-4-phosphorosophenyl]phenol (PubChem CID 141093976) has the molecular formula C24H17O4P and a molecular weight of 400.37 g/mol. Its IUPAC name is 2-[2,3-bis(2-hydroxyphenyl)-4-phosphorosophenyl]phenol.
| Compound Name | 2-[2,3-bis(2-hydroxyphenyl)-4-phosphorosophenyl]phenol |
|---|---|
| PubChem CID | 141093976 |
| Molecular Formula | C24H17O4P |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 2-[2,3-bis(2-hydroxyphenyl)-4-phosphorosophenyl]phenol |
| SMILES | O=Pc1ccc(-c2ccccc2O)c(-c2ccccc2O)c1-c1ccccc1O |
| InChI | InChI=1S/C24H17O4P/c25-19-10-4-1-7-15(19)16-13-14-22(29-28)24(18-9-3-6-12-21(18)27)23(16)17-8-2-5-11-20(17)26/h1-14,25-27H |
| InChIKey | MFKKQFMTXLNIGB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|