C8H15N3O3 — CID 141094505
4-[(2Z)-2-amino-2-hydroxyiminoethyl]piperidine-1-carboxylic acid (PubChem CID 141094505) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is 4-[(2Z)-2-amino-2-hydroxyiminoethyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[(2Z)-2-amino-2-hydroxyiminoethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141094505 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 4-[(2Z)-2-amino-2-hydroxyiminoethyl]piperidine-1-carboxylic acid |
| SMILES | N/C(CC1CCN(C(=O)O)CC1)=N\O |
| InChI | InChI=1S/C8H15N3O3/c9-7(10-14)5-6-1-3-11(4-2-6)8(12)13/h6,14H,1-5H2,(H2,9,10)(H,12,13) |
| InChIKey | KIBMFMLUTRFSDE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|