C21H20N2O8 — CID 141094694
1-[5-[4-(2-carboxy-2-oxoethyl)phenoxy]-2-nitrophenyl]piperidine-4-carboxylic acid (PubChem CID 141094694) has the molecular formula C21H20N2O8 and a molecular weight of 428.40 g/mol. Its IUPAC name is 1-[5-[4-(2-carboxy-2-oxoethyl)phenoxy]-2-nitrophenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[5-[4-(2-carboxy-2-oxoethyl)phenoxy]-2-nitrophenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 141094694 |
| Molecular Formula | C21H20N2O8 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-[5-[4-(2-carboxy-2-oxoethyl)phenoxy]-2-nitrophenyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C(=O)Cc1ccc(Oc2ccc([N+](=O)[O-])c(N3CCC(C(=O)O)CC3)c2)cc1 |
| InChI | InChI=1S/C21H20N2O8/c24-19(21(27)28)11-13-1-3-15(4-2-13)31-16-5-6-17(23(29)30)18(12-16)22-9-7-14(8-10-22)20(25)26/h1-6,12,14H,7-11H2,(H,25,26)(H,27,28) |
| InChIKey | YXIPEURVYVKHSO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 147.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|