About 3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine
3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine (PubChem CID 141094760) has the molecular formula C7H9Cl2NO
and a molecular weight of 194.06 g/mol. Its IUPAC name is 3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine |
| PubChem CID | 141094760 |
| Molecular Formula | C7H9Cl2NO |
| Molecular Weight | 194.06 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | 3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine |
| SMILES | COC1(Cl)C=C(N)C(Cl)=CC1 |
| InChI | InChI=1S/C7H9Cl2NO/c1-11-7(9)3-2-5(8)6(10)4-7/h2,4H,3,10H2,1H3 |
| InChIKey | YSIQFASBIRNYNH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.06 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine?
The IUPAC name of 3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine (CID 141094760) is 3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine?
The canonical SMILES for 3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine is COC1(Cl)C=C(N)C(Cl)=CC1.
What is the InChIKey of 3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine?
The InChIKey is YSIQFASBIRNYNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl2NO/c1-11-7(9)3-2-5(8)6(10)4-7/h2,4H,3,10H2,1H3.
What are the key properties of 3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine?
3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine has a molecular weight of 194.06 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloro-3-methoxycyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 141094760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).