C7H9ClN2S — CID 141094880
5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine;hydrochloride (PubChem CID 141094880) has the molecular formula C7H9ClN2S and a molecular weight of 188.68 g/mol. Its IUPAC name is 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine;hydrochloride.
| Compound Name | 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 141094880 |
| Molecular Formula | C7H9ClN2S |
| Molecular Weight | 188.68 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine;hydrochloride |
| SMILES | C#CCNc1ncc(C)s1.Cl |
| InChI | InChI=1S/C7H8N2S.ClH/c1-3-4-8-7-9-5-6(2)10-7;/h1,5H,4H2,2H3,(H,8,9);1H |
| InChIKey | KTXCIJZFYVEYQT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|