About 2-butylpyridazin-3-one;hydrochloride
2-butylpyridazin-3-one;hydrochloride (PubChem CID 141096012) has the molecular formula C8H13ClN2O
and a molecular weight of 188.66 g/mol. Its IUPAC name is 2-butylpyridazin-3-one;hydrochloride.
Molecular Properties
| Compound Name | 2-butylpyridazin-3-one;hydrochloride |
| PubChem CID | 141096012 |
| Molecular Formula | C8H13ClN2O |
| Molecular Weight | 188.66 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 2-butylpyridazin-3-one;hydrochloride |
| SMILES | CCCCn1ncccc1=O.Cl |
| InChI | InChI=1S/C8H12N2O.ClH/c1-2-3-7-10-8(11)5-4-6-9-10;/h4-6H,2-3,7H2,1H3;1H |
| InChIKey | WZDDVNQXDJKGPA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.66 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butylpyridazin-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylpyridazin-3-one;hydrochloride?
The IUPAC name of 2-butylpyridazin-3-one;hydrochloride (CID 141096012) is 2-butylpyridazin-3-one;hydrochloride.
What is the SMILES notation for 2-butylpyridazin-3-one;hydrochloride?
The canonical SMILES for 2-butylpyridazin-3-one;hydrochloride is CCCCn1ncccc1=O.Cl.
What is the InChIKey of 2-butylpyridazin-3-one;hydrochloride?
The InChIKey is WZDDVNQXDJKGPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O.ClH/c1-2-3-7-10-8(11)5-4-6-9-10;/h4-6H,2-3,7H2,1H3;1H.
What are the key properties of 2-butylpyridazin-3-one;hydrochloride?
2-butylpyridazin-3-one;hydrochloride has a molecular weight of 188.66 g/mol, XLogP of 1.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylpyridazin-3-one;hydrochloride is sourced from PubChem (CID 141096012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).