C10H13F3N2O4 — CID 141096086
4-(2-methyl-1H-imidazol-3-ium-3-yl)butanoic acid;2,2,2-trifluoroacetate (PubChem CID 141096086) has the molecular formula C10H13F3N2O4 and a molecular weight of 282.22 g/mol. Its IUPAC name is 4-(2-methyl-1H-imidazol-3-ium-3-yl)butanoic acid;2,2,2-trifluoroacetate.
| Compound Name | 4-(2-methyl-1H-imidazol-3-ium-3-yl)butanoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 141096086 |
| Molecular Formula | C10H13F3N2O4 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-(2-methyl-1H-imidazol-3-ium-3-yl)butanoic acid;2,2,2-trifluoroacetate |
| SMILES | Cc1[nH]cc[n+]1CCCC(=O)O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C8H12N2O2.C2HF3O2/c1-7-9-4-6-10(7)5-2-3-8(11)12;3-2(4,5)1(6)7/h4,6H,2-3,5H2,1H3,(H,11,12);(H,6,7) |
| InChIKey | WFCRNHAWOHZJSY-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|