About pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate
pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate (PubChem CID 141096509) has the molecular formula C9H13NO2S2
and a molecular weight of 231.34 g/mol. Its IUPAC name is pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate.
Molecular Properties
| Compound Name | pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate |
| PubChem CID | 141096509 |
| Molecular Formula | C9H13NO2S2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate |
| SMILES | CCCCCOC(=O)n1ccsc1=S |
| InChI | InChI=1S/C9H13NO2S2/c1-2-3-4-6-12-8(11)10-5-7-14-9(10)13/h5,7H,2-4,6H2,1H3 |
| InChIKey | LICBQBRBVHXCAR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate?
The IUPAC name of pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate (CID 141096509) is pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate.
What is the SMILES notation for pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate?
The canonical SMILES for pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate is CCCCCOC(=O)n1ccsc1=S.
What is the InChIKey of pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate?
The InChIKey is LICBQBRBVHXCAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S2/c1-2-3-4-6-12-8(11)10-5-7-14-9(10)13/h5,7H,2-4,6H2,1H3.
What are the key properties of pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate?
pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate has a molecular weight of 231.34 g/mol, XLogP of 3.45, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 2-sulfanylidene-1,3-thiazole-3-carboxylate is sourced from PubChem (CID 141096509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).