C10H20N4O4S — CID 141098602
4-(butylsulfonylamino)pyrrolidine-1,2-dicarboxamide (PubChem CID 141098602) has the molecular formula C10H20N4O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-(butylsulfonylamino)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 4-(butylsulfonylamino)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 141098602 |
| Molecular Formula | C10H20N4O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 4-(butylsulfonylamino)pyrrolidine-1,2-dicarboxamide |
| SMILES | CCCCS(=O)(=O)NC1CC(C(N)=O)N(C(N)=O)C1 |
| InChI | InChI=1S/C10H20N4O4S/c1-2-3-4-19(17,18)13-7-5-8(9(11)15)14(6-7)10(12)16/h7-8,13H,2-6H2,1H3,(H2,11,15)(H2,12,16) |
| InChIKey | HXVTVWDXONVDPZ-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |