About 4,4-dimethoxypyrrolidine-1,2-dicarboxamide
4,4-dimethoxypyrrolidine-1,2-dicarboxamide (PubChem CID 141098654) has the molecular formula C8H15N3O4
and a molecular weight of 217.22 g/mol. Its IUPAC name is 4,4-dimethoxypyrrolidine-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 4,4-dimethoxypyrrolidine-1,2-dicarboxamide |
| PubChem CID | 141098654 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 4,4-dimethoxypyrrolidine-1,2-dicarboxamide |
| SMILES | COC1(OC)CC(C(N)=O)N(C(N)=O)C1 |
| InChI | InChI=1S/C8H15N3O4/c1-14-8(15-2)3-5(6(9)12)11(4-8)7(10)13/h5H,3-4H2,1-2H3,(H2,9,12)(H2,10,13) |
| InChIKey | HLBFYRJXWZHMMA-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethoxypyrrolidine-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethoxypyrrolidine-1,2-dicarboxamide?
The IUPAC name of 4,4-dimethoxypyrrolidine-1,2-dicarboxamide (CID 141098654) is 4,4-dimethoxypyrrolidine-1,2-dicarboxamide.
What is the SMILES notation for 4,4-dimethoxypyrrolidine-1,2-dicarboxamide?
The canonical SMILES for 4,4-dimethoxypyrrolidine-1,2-dicarboxamide is COC1(OC)CC(C(N)=O)N(C(N)=O)C1.
What is the InChIKey of 4,4-dimethoxypyrrolidine-1,2-dicarboxamide?
The InChIKey is HLBFYRJXWZHMMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O4/c1-14-8(15-2)3-5(6(9)12)11(4-8)7(10)13/h5H,3-4H2,1-2H3,(H2,9,12)(H2,10,13).
What are the key properties of 4,4-dimethoxypyrrolidine-1,2-dicarboxamide?
4,4-dimethoxypyrrolidine-1,2-dicarboxamide has a molecular weight of 217.22 g/mol, XLogP of -1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethoxypyrrolidine-1,2-dicarboxamide is sourced from PubChem (CID 141098654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).