About (E)-1,5-diisocyanato-3-methylpent-1-ene
(E)-1,5-diisocyanato-3-methylpent-1-ene (PubChem CID 141098784) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is (E)-1,5-diisocyanato-3-methylpent-1-ene.
Molecular Properties
| Compound Name | (E)-1,5-diisocyanato-3-methylpent-1-ene |
| PubChem CID | 141098784 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (E)-1,5-diisocyanato-3-methylpent-1-ene |
| SMILES | CC(/C=C/N=C=O)CCN=C=O |
| InChI | InChI=1S/C8H10N2O2/c1-8(2-4-9-6-11)3-5-10-7-12/h2,4,8H,3,5H2,1H3/b4-2+ |
| InChIKey | ZUBWOQFOOAFQSL-DUXPYHPUSA-N |
| XLogP | 1.20 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,5-diisocyanato-3-methylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,5-diisocyanato-3-methylpent-1-ene?
The IUPAC name of (E)-1,5-diisocyanato-3-methylpent-1-ene (CID 141098784) is (E)-1,5-diisocyanato-3-methylpent-1-ene.
What is the SMILES notation for (E)-1,5-diisocyanato-3-methylpent-1-ene?
The canonical SMILES for (E)-1,5-diisocyanato-3-methylpent-1-ene is CC(/C=C/N=C=O)CCN=C=O.
What is the InChIKey of (E)-1,5-diisocyanato-3-methylpent-1-ene?
The InChIKey is ZUBWOQFOOAFQSL-DUXPYHPUSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-8(2-4-9-6-11)3-5-10-7-12/h2,4,8H,3,5H2,1H3/b4-2+.
What are the key properties of (E)-1,5-diisocyanato-3-methylpent-1-ene?
(E)-1,5-diisocyanato-3-methylpent-1-ene has a molecular weight of 166.18 g/mol, XLogP of 1.20, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,5-diisocyanato-3-methylpent-1-ene is sourced from PubChem (CID 141098784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).