C21H31NO6 — CID 141098880
tert-butyl 4-[(2-ethoxycarbonyl-6-methoxyphenoxy)methyl]piperidine-1-carboxylate (PubChem CID 141098880) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is tert-butyl 4-[(2-ethoxycarbonyl-6-methoxyphenoxy)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-ethoxycarbonyl-6-methoxyphenoxy)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 141098880 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | tert-butyl 4-[(2-ethoxycarbonyl-6-methoxyphenoxy)methyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)c1cccc(OC)c1OCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H31NO6/c1-6-26-19(23)16-8-7-9-17(25-5)18(16)27-14-15-10-12-22(13-11-15)20(24)28-21(2,3)4/h7-9,15H,6,10-14H2,1-5H3 |
| InChIKey | JYGIZIXYHJQGSN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |