About 2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole
2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole (PubChem CID 141098907) has the molecular formula C23H13N5O2S2
and a molecular weight of 455.52 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole |
| PubChem CID | 141098907 |
| Molecular Formula | C23H13N5O2S2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nccs2)c(-c2nc3ccccc3[nH]2)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H13N5O2S2/c29-28(30)17-10-9-13(22-24-11-12-31-22)19(21-25-14-5-1-2-6-15(14)26-21)20(17)23-27-16-7-3-4-8-18(16)32-23/h1-12H,(H,25,26) |
| InChIKey | VKQAQNRNNSGWPK-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole?
The IUPAC name of 2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole (CID 141098907) is 2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole?
The canonical SMILES for 2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole is O=[N+]([O-])c1ccc(-c2nccs2)c(-c2nc3ccccc3[nH]2)c1-c1nc2ccccc2s1.
What is the InChIKey of 2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole?
The InChIKey is VKQAQNRNNSGWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13N5O2S2/c29-28(30)17-10-9-13(22-24-11-12-31-22)19(21-25-14-5-1-2-6-15(14)26-21)20(17)23-27-16-7-3-4-8-18(16)32-23/h1-12H,(H,25,26).
What are the key properties of 2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole?
2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole has a molecular weight of 455.52 g/mol, XLogP of 6.54, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1H-benzimidazol-2-yl)-6-nitro-3-(1,3-thiazol-2-yl)phenyl]-1,3-benzothiazole is sourced from PubChem (CID 141098907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).