C31H30N4O2S — CID 141098916
3-(furan-2-yl)-4-piperidin-1-yl-2-pyridin-2-yl-2-quinolin-2-yl-3-thiophen-2-ylmorpholine (PubChem CID 141098916) has the molecular formula C31H30N4O2S and a molecular weight of 522.67 g/mol. Its IUPAC name is 3-(furan-2-yl)-4-piperidin-1-yl-2-pyridin-2-yl-2-quinolin-2-yl-3-thiophen-2-ylmorpholine.
| Compound Name | 3-(furan-2-yl)-4-piperidin-1-yl-2-pyridin-2-yl-2-quinolin-2-yl-3-thiophen-2-ylmorpholine |
|---|---|
| PubChem CID | 141098916 |
| Molecular Formula | C31H30N4O2S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 3-(furan-2-yl)-4-piperidin-1-yl-2-pyridin-2-yl-2-quinolin-2-yl-3-thiophen-2-ylmorpholine |
| SMILES | c1ccc(C2(c3ccc4ccccc4n3)OCCN(N3CCCCC3)C2(c2ccco2)c2cccs2)nc1 |
| InChI | InChI=1S/C31H30N4O2S/c1-6-18-34(19-7-1)35-20-22-37-31(26-12-4-5-17-32-26,27-16-15-24-10-2-3-11-25(24)33-27)30(35,28-13-8-21-36-28)29-14-9-23-38-29/h2-5,8-17,21,23H,1,6-7,18-20,22H2 |
| InChIKey | KFDZZKLMELHITJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |