About methyl 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)acetate
methyl 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)acetate (PubChem CID 141099553) has the molecular formula C9H12F2O2
and a molecular weight of 190.19 g/mol. Its IUPAC name is methyl 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)acetate.
Analyze methyl 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)acetate?
The IUPAC name of methyl 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)acetate (CID 141099553) is methyl 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)acetate.
What is the SMILES notation for methyl 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)acetate?
The canonical SMILES for methyl 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)acetate is COC(=O)CC1CC2C(C1)C2(F)F.
What is the InChIKey of methyl 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)acetate?
The InChIKey is VARKVTRWVFXMQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2O2/c1-13-8(12)4-5-2-6-7(3-5)9(6,10)11/h5-7H,2-4H2,1H3.
What are the key properties of methyl 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)acetate?
methyl 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)acetate has a molecular weight of 190.19 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)acetate is sourced from PubChem (CID 141099553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).