C6H6O5 — CID 141100331
3,4,5,6-tetrahydroxycyclohexa-2,4-dien-1-one (PubChem CID 141100331) has the molecular formula C6H6O5 and a molecular weight of 158.11 g/mol. Its IUPAC name is 3,4,5,6-tetrahydroxycyclohexa-2,4-dien-1-one.
| Compound Name | 3,4,5,6-tetrahydroxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 141100331 |
| Molecular Formula | C6H6O5 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | 3,4,5,6-tetrahydroxycyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=C(O)C(O)=C(O)C1O |
| InChI | InChI=1S/C6H6O5/c7-2-1-3(8)5(10)6(11)4(2)9/h1,4,8-11H |
| InChIKey | PGPVMUPEKNJFGT-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |