About N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide
N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide (PubChem CID 141100811) has the molecular formula C15H10BrN3O3
and a molecular weight of 360.17 g/mol. Its IUPAC name is N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide.
Molecular Properties
| Compound Name | N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide |
| PubChem CID | 141100811 |
| Molecular Formula | C15H10BrN3O3 |
| Molecular Weight | 360.17 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide |
| SMILES | O=CNC(=O)N(c1cccc(Br)c1)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C15H10BrN3O3/c16-10-2-1-3-11(6-10)19(15(21)17-8-20)12-4-5-14-13(7-12)18-9-22-14/h1-9H,(H,17,20,21) |
| InChIKey | IVWRVLYMZBSDQG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.17 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide?
The IUPAC name of N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide (CID 141100811) is N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide.
What is the SMILES notation for N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide?
The canonical SMILES for N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide is O=CNC(=O)N(c1cccc(Br)c1)c1ccc2ocnc2c1.
What is the InChIKey of N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide?
The InChIKey is IVWRVLYMZBSDQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrN3O3/c16-10-2-1-3-11(6-10)19(15(21)17-8-20)12-4-5-14-13(7-12)18-9-22-14/h1-9H,(H,17,20,21).
What are the key properties of N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide?
N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide has a molecular weight of 360.17 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1,3-benzoxazol-5-yl-(3-bromophenyl)carbamoyl]formamide is sourced from PubChem (CID 141100811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).