C23H26ClF3N2O — CID 141101154
[2-chloro-4-[N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenyl]methanamine (PubChem CID 141101154) has the molecular formula C23H26ClF3N2O and a molecular weight of 438.92 g/mol. Its IUPAC name is [2-chloro-4-[N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenyl]methanamine.
| Compound Name | [2-chloro-4-[N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenyl]methanamine |
|---|---|
| PubChem CID | 141101154 |
| Molecular Formula | C23H26ClF3N2O |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [2-chloro-4-[N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]phenyl]methanamine |
| SMILES | CC(=NOCc1ccc(C2CCCCC2)c(C(F)(F)F)c1)c1ccc(CN)c(Cl)c1 |
| InChI | InChI=1S/C23H26ClF3N2O/c1-15(18-8-9-19(13-28)22(24)12-18)29-30-14-16-7-10-20(17-5-3-2-4-6-17)21(11-16)23(25,26)27/h7-12,17H,2-6,13-14,28H2,1H3 |
| InChIKey | HYROZDCYPHRRTH-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|