About 6-iodo-4H-pyrrolo[3,2-f]quinazoline
6-iodo-4H-pyrrolo[3,2-f]quinazoline (PubChem CID 141101168) has the molecular formula C10H6IN3
and a molecular weight of 295.08 g/mol. Its IUPAC name is 6-iodo-4H-pyrrolo[3,2-f]quinazoline.
Molecular Properties
| Compound Name | 6-iodo-4H-pyrrolo[3,2-f]quinazoline |
| PubChem CID | 141101168 |
| Molecular Formula | C10H6IN3 |
| Molecular Weight | 295.08 g/mol |
| Exact Mass | 294.96 |
| IUPAC Name | 6-iodo-4H-pyrrolo[3,2-f]quinazoline |
| SMILES | Ic1cc2[nH]cncc2c2ccnc12 |
| InChI | InChI=1S/C10H6IN3/c11-8-3-9-7(4-12-5-14-9)6-1-2-13-10(6)8/h1-5H,(H,12,14) |
| InChIKey | IRWARJXZSULERA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.08 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-4H-pyrrolo[3,2-f]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-4H-pyrrolo[3,2-f]quinazoline?
The IUPAC name of 6-iodo-4H-pyrrolo[3,2-f]quinazoline (CID 141101168) is 6-iodo-4H-pyrrolo[3,2-f]quinazoline.
What is the SMILES notation for 6-iodo-4H-pyrrolo[3,2-f]quinazoline?
The canonical SMILES for 6-iodo-4H-pyrrolo[3,2-f]quinazoline is Ic1cc2[nH]cncc2c2ccnc12.
What is the InChIKey of 6-iodo-4H-pyrrolo[3,2-f]quinazoline?
The InChIKey is IRWARJXZSULERA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6IN3/c11-8-3-9-7(4-12-5-14-9)6-1-2-13-10(6)8/h1-5H,(H,12,14).
What are the key properties of 6-iodo-4H-pyrrolo[3,2-f]quinazoline?
6-iodo-4H-pyrrolo[3,2-f]quinazoline has a molecular weight of 295.08 g/mol, XLogP of 2.72, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-4H-pyrrolo[3,2-f]quinazoline is sourced from PubChem (CID 141101168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).