About 8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline
8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline (PubChem CID 141101579) has the molecular formula C17H20ClNO2
and a molecular weight of 305.81 g/mol. Its IUPAC name is 8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline.
Molecular Properties
| Compound Name | 8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline |
| PubChem CID | 141101579 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline |
| SMILES | CC1CCC(N2CC=C(Cl)c3cc4c(cc32)OCO4)CC1 |
| InChI | InChI=1S/C17H20ClNO2/c1-11-2-4-12(5-3-11)19-7-6-14(18)13-8-16-17(9-15(13)19)21-10-20-16/h6,8-9,11-12H,2-5,7,10H2,1H3 |
| InChIKey | QXDGWQFPAVLQOI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline?
The IUPAC name of 8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline (CID 141101579) is 8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline.
What is the SMILES notation for 8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline?
The canonical SMILES for 8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline is CC1CCC(N2CC=C(Cl)c3cc4c(cc32)OCO4)CC1.
What is the InChIKey of 8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline?
The InChIKey is QXDGWQFPAVLQOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClNO2/c1-11-2-4-12(5-3-11)19-7-6-14(18)13-8-16-17(9-15(13)19)21-10-20-16/h6,8-9,11-12H,2-5,7,10H2,1H3.
What are the key properties of 8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline?
8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline has a molecular weight of 305.81 g/mol, XLogP of 4.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5-(4-methylcyclohexyl)-6H-[1,3]dioxolo[4,5-g]quinoline is sourced from PubChem (CID 141101579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).