C26H48OS2 — CID 141101845
6,6-dimethyl-2,4-bis(octylsulfanylmethyl)cyclohexa-2,4-dien-1-ol (PubChem CID 141101845) has the molecular formula C26H48OS2 and a molecular weight of 440.80 g/mol. Its IUPAC name is 6,6-dimethyl-2,4-bis(octylsulfanylmethyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 6,6-dimethyl-2,4-bis(octylsulfanylmethyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 141101845 |
| Molecular Formula | C26H48OS2 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | 6,6-dimethyl-2,4-bis(octylsulfanylmethyl)cyclohexa-2,4-dien-1-ol |
| SMILES | CCCCCCCCSCC1=CC(C)(C)C(O)C(CSCCCCCCCC)=C1 |
| InChI | InChI=1S/C26H48OS2/c1-5-7-9-11-13-15-17-28-21-23-19-24(25(27)26(3,4)20-23)22-29-18-16-14-12-10-8-6-2/h19-20,25,27H,5-18,21-22H2,1-4H3 |
| InChIKey | SYANMTRIKMEWKA-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|