C19H19Cl2FN2O — CID 141102174
(2,4-dichloro-5-fluorophenyl)-(3-ethyl-6,7-dimethyl-3,4-dihydro-2H-quinoxalin-1-yl)methanone (PubChem CID 141102174) has the molecular formula C19H19Cl2FN2O and a molecular weight of 381.28 g/mol. Its IUPAC name is (2,4-dichloro-5-fluorophenyl)-(3-ethyl-6,7-dimethyl-3,4-dihydro-2H-quinoxalin-1-yl)methanone.
| Compound Name | (2,4-dichloro-5-fluorophenyl)-(3-ethyl-6,7-dimethyl-3,4-dihydro-2H-quinoxalin-1-yl)methanone |
|---|---|
| PubChem CID | 141102174 |
| Molecular Formula | C19H19Cl2FN2O |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (2,4-dichloro-5-fluorophenyl)-(3-ethyl-6,7-dimethyl-3,4-dihydro-2H-quinoxalin-1-yl)methanone |
| SMILES | CCC1CN(C(=O)c2cc(F)c(Cl)cc2Cl)c2cc(C)c(C)cc2N1 |
| InChI | InChI=1S/C19H19Cl2FN2O/c1-4-12-9-24(18-6-11(3)10(2)5-17(18)23-12)19(25)13-7-16(22)15(21)8-14(13)20/h5-8,12,23H,4,9H2,1-3H3 |
| InChIKey | CUUXGXWBHDTNNH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|