C27H45ClO — CID 141102658
(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoyl chloride (PubChem CID 141102658) has the molecular formula C27H45ClO and a molecular weight of 421.11 g/mol. Its IUPAC name is (6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoyl chloride.
| Compound Name | (6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoyl chloride |
|---|---|
| PubChem CID | 141102658 |
| Molecular Formula | C27H45ClO |
| Molecular Weight | 421.11 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | (6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoyl chloride |
| SMILES | CC(CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C)C(=O)Cl |
| InChI | InChI=1S/C27H45ClO/c1-18(8-7-9-19(2)25(28)29)22-13-14-23-21-12-11-20-10-5-6-16-26(20,3)24(21)15-17-27(22,23)4/h18-24H,5-17H2,1-4H3/t18-,19?,20?,21+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | ACQUNVBJLUEQKZ-BDVVBNJOSA-N |
| XLogP | 8.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.11 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|