C8H15N3 — CID 141103066
1-pyrrolidin-3-yl-5,6-dihydro-4H-pyrimidine (PubChem CID 141103066) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-pyrrolidin-3-yl-5,6-dihydro-4H-pyrimidine.
| Compound Name | 1-pyrrolidin-3-yl-5,6-dihydro-4H-pyrimidine |
|---|---|
| PubChem CID | 141103066 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1-pyrrolidin-3-yl-5,6-dihydro-4H-pyrimidine |
| SMILES | C1=NCCCN1C1CCNC1 |
| InChI | InChI=1S/C8H15N3/c1-3-10-7-11(5-1)8-2-4-9-6-8/h7-9H,1-6H2 |
| InChIKey | SMJSBQYSDRNVQA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |