C7H8F3NOS — CID 141103127
(2R)-1,1,1-trifluoro-2-(1,3-thiazol-5-yl)butan-2-ol (PubChem CID 141103127) has the molecular formula C7H8F3NOS and a molecular weight of 211.21 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-2-(1,3-thiazol-5-yl)butan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-2-(1,3-thiazol-5-yl)butan-2-ol |
|---|---|
| PubChem CID | 141103127 |
| Molecular Formula | C7H8F3NOS |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | (2R)-1,1,1-trifluoro-2-(1,3-thiazol-5-yl)butan-2-ol |
| SMILES | CC[C@](O)(c1cncs1)C(F)(F)F |
| InChI | InChI=1S/C7H8F3NOS/c1-2-6(12,7(8,9)10)5-3-11-4-13-5/h3-4,12H,2H2,1H3/t6-/m0/s1 |
| InChIKey | MKFNZHJMLYGRSD-LURJTMIESA-N |
| XLogP | 2.30 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |