C21H18N2O6 — CID 14110350
(2R,3R)-1-[(2,4-dimethoxyphenyl)methyl]-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carbaldehyde (PubChem CID 14110350) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is (2R,3R)-1-[(2,4-dimethoxyphenyl)methyl]-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carbaldehyde.
| Compound Name | (2R,3R)-1-[(2,4-dimethoxyphenyl)methyl]-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carbaldehyde |
|---|---|
| PubChem CID | 14110350 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (2R,3R)-1-[(2,4-dimethoxyphenyl)methyl]-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidine-2-carbaldehyde |
| SMILES | COc1ccc(CN2C(=O)[C@H](N3C(=O)c4ccccc4C3=O)[C@@H]2C=O)c(OC)c1 |
| InChI | InChI=1S/C21H18N2O6/c1-28-13-8-7-12(17(9-13)29-2)10-22-16(11-24)18(21(22)27)23-19(25)14-5-3-4-6-15(14)20(23)26/h3-9,11,16,18H,10H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | LZOCIYNBYKRANU-FUHWJXTLSA-N |
| XLogP | 1.28 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|