About indolizine-1,2,3-triol
indolizine-1,2,3-triol (PubChem CID 141103866) has the molecular formula C8H7NO3
and a molecular weight of 165.15 g/mol. Its IUPAC name is indolizine-1,2,3-triol.
Molecular Properties
| Compound Name | indolizine-1,2,3-triol |
| PubChem CID | 141103866 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | indolizine-1,2,3-triol |
| SMILES | Oc1c(O)c2ccccn2c1O |
| InChI | InChI=1S/C8H7NO3/c10-6-5-3-1-2-4-9(5)8(12)7(6)11/h1-4,10-12H |
| InChIKey | XWOMHOBTJQHMDS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze indolizine-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indolizine-1,2,3-triol?
The IUPAC name of indolizine-1,2,3-triol (CID 141103866) is indolizine-1,2,3-triol.
What is the SMILES notation for indolizine-1,2,3-triol?
The canonical SMILES for indolizine-1,2,3-triol is Oc1c(O)c2ccccn2c1O.
What is the InChIKey of indolizine-1,2,3-triol?
The InChIKey is XWOMHOBTJQHMDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3/c10-6-5-3-1-2-4-9(5)8(12)7(6)11/h1-4,10-12H.
What are the key properties of indolizine-1,2,3-triol?
indolizine-1,2,3-triol has a molecular weight of 165.15 g/mol, XLogP of 1.06, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for indolizine-1,2,3-triol is sourced from PubChem (CID 141103866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).