C14H24O — CID 141104109
1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthren-1-ol (PubChem CID 141104109) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthren-1-ol.
| Compound Name | 1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthren-1-ol |
|---|---|
| PubChem CID | 141104109 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthren-1-ol |
| SMILES | OC1CCCC2C1CCC1CCCCC12 |
| InChI | InChI=1S/C14H24O/c15-14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h10-15H,1-9H2 |
| InChIKey | LECGDAIXZWWGSQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |