C21H36O5 — CID 141104272
(13Z)-7-ethyl-8,8-dihydroxy-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 141104272) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is (13Z)-7-ethyl-8,8-dihydroxy-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (13Z)-7-ethyl-8,8-dihydroxy-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 141104272 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | (13Z)-7-ethyl-8,8-dihydroxy-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CCC1C(=O)C(C)(C)CCC(=O)OCC/C=C(/C)CCCC(C)C1(O)O |
| InChI | InChI=1S/C21H36O5/c1-6-17-19(23)20(4,5)13-12-18(22)26-14-8-10-15(2)9-7-11-16(3)21(17,24)25/h10,16-17,24-25H,6-9,11-14H2,1-5H3/b15-10- |
| InChIKey | XGFWQUNNFRDUIT-GDNBJRDFSA-N |
| XLogP | 3.77 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|