About 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole
4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole (PubChem CID 141104315) has the molecular formula C23H28N2O2
and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole.
Molecular Properties
| Compound Name | 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole |
| PubChem CID | 141104315 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole |
| SMILES | CCCOc1ccc(C=C2C=NN(c3ccccc3)C2)c(OCCC)c1C |
| InChI | InChI=1S/C23H28N2O2/c1-4-13-26-22-12-11-20(23(18(22)3)27-14-5-2)15-19-16-24-25(17-19)21-9-7-6-8-10-21/h6-12,15-16H,4-5,13-14,17H2,1-3H3 |
| InChIKey | VQBNDWBLMODVRD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole?
The IUPAC name of 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole (CID 141104315) is 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole.
What is the SMILES notation for 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole?
The canonical SMILES for 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole is CCCOc1ccc(C=C2C=NN(c3ccccc3)C2)c(OCCC)c1C.
What is the InChIKey of 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole?
The InChIKey is VQBNDWBLMODVRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O2/c1-4-13-26-22-12-11-20(23(18(22)3)27-14-5-2)15-19-16-24-25(17-19)21-9-7-6-8-10-21/h6-12,15-16H,4-5,13-14,17H2,1-3H3.
What are the key properties of 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole?
4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole has a molecular weight of 364.49 g/mol, XLogP of 5.46, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-methyl-2,4-dipropoxyphenyl)methylidene]-2-phenyl-3H-pyrazole is sourced from PubChem (CID 141104315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).