C14H16ClN3O3 — CID 141104395
(13R)-4-chloro-5-ethoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-11-carboxylic acid (PubChem CID 141104395) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is (13R)-4-chloro-5-ethoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-11-carboxylic acid.
| Compound Name | (13R)-4-chloro-5-ethoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 141104395 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | (13R)-4-chloro-5-ethoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-11-carboxylic acid |
| SMILES | CCOc1cc2cc3n(c2nc1Cl)[C@H](C)CN(C(=O)O)C3 |
| InChI | InChI=1S/C14H16ClN3O3/c1-3-21-11-5-9-4-10-7-17(14(19)20)6-8(2)18(10)13(9)16-12(11)15/h4-5,8H,3,6-7H2,1-2H3,(H,19,20)/t8-/m1/s1 |
| InChIKey | CJKXBMHJIABNEU-MRVPVSSYSA-N |
| XLogP | 3.14 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|