About 2-octyl-2H-pyran-3-thiol
2-octyl-2H-pyran-3-thiol (PubChem CID 141104563) has the molecular formula C13H22OS
and a molecular weight of 226.39 g/mol. Its IUPAC name is 2-octyl-2H-pyran-3-thiol.
Molecular Properties
| Compound Name | 2-octyl-2H-pyran-3-thiol |
| PubChem CID | 141104563 |
| Molecular Formula | C13H22OS |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2-octyl-2H-pyran-3-thiol |
| SMILES | CCCCCCCCC1OC=CC=C1S |
| InChI | InChI=1S/C13H22OS/c1-2-3-4-5-6-7-9-12-13(15)10-8-11-14-12/h8,10-12,15H,2-7,9H2,1H3 |
| InChIKey | MNYBUBAAIBUESO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-octyl-2H-pyran-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octyl-2H-pyran-3-thiol?
The IUPAC name of 2-octyl-2H-pyran-3-thiol (CID 141104563) is 2-octyl-2H-pyran-3-thiol.
What is the SMILES notation for 2-octyl-2H-pyran-3-thiol?
The canonical SMILES for 2-octyl-2H-pyran-3-thiol is CCCCCCCCC1OC=CC=C1S.
What is the InChIKey of 2-octyl-2H-pyran-3-thiol?
The InChIKey is MNYBUBAAIBUESO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22OS/c1-2-3-4-5-6-7-9-12-13(15)10-8-11-14-12/h8,10-12,15H,2-7,9H2,1H3.
What are the key properties of 2-octyl-2H-pyran-3-thiol?
2-octyl-2H-pyran-3-thiol has a molecular weight of 226.39 g/mol, XLogP of 4.46, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octyl-2H-pyran-3-thiol is sourced from PubChem (CID 141104563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).